C25H30N6O — CID 69269868
2-methoxy-9-methyl-3-N-(3-pyrrolidin-1-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine (PubChem CID 69269868) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 2-methoxy-9-methyl-3-N-(3-pyrrolidin-1-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine.
| Compound Name | 2-methoxy-9-methyl-3-N-(3-pyrrolidin-1-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
|---|---|
| PubChem CID | 69269868 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-methoxy-9-methyl-3-N-(3-pyrrolidin-1-ylpropyl)quinolino[3,4-c]quinoline-3,7,10-triamine |
| SMILES | COc1cc2c(cc1NCCCN1CCCC1)ncc1c(N)nc3c(C)c(N)ccc3c12 |
| InChI | InChI=1S/C25H30N6O/c1-15-19(26)7-6-16-23-17-12-22(32-2)21(28-8-5-11-31-9-3-4-10-31)13-20(17)29-14-18(23)25(27)30-24(15)16/h6-7,12-14,28H,3-5,8-11,26H2,1-2H3,(H2,27,30) |
| InChIKey | GGDNRLGONJWADX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|