C21H25N5O3 — CID 69270387
4,5,6-trimethoxy-1-[3-(pyrimidin-5-ylmethyl)piperidin-1-yl]phthalazine (PubChem CID 69270387) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4,5,6-trimethoxy-1-[3-(pyrimidin-5-ylmethyl)piperidin-1-yl]phthalazine.
| Compound Name | 4,5,6-trimethoxy-1-[3-(pyrimidin-5-ylmethyl)piperidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 69270387 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4,5,6-trimethoxy-1-[3-(pyrimidin-5-ylmethyl)piperidin-1-yl]phthalazine |
| SMILES | COc1ccc2c(N3CCCC(Cc4cncnc4)C3)nnc(OC)c2c1OC |
| InChI | InChI=1S/C21H25N5O3/c1-27-17-7-6-16-18(19(17)28-2)21(29-3)25-24-20(16)26-8-4-5-14(12-26)9-15-10-22-13-23-11-15/h6-7,10-11,13-14H,4-5,8-9,12H2,1-3H3 |
| InChIKey | MBMWYGPRTJBCIR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |