C16H21N5S — CID 69273251
4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)thiophen-2-yl]-N-methylpyrimidin-2-amine (PubChem CID 69273251) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)thiophen-2-yl]-N-methylpyrimidin-2-amine.
| Compound Name | 4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)thiophen-2-yl]-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 69273251 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)thiophen-2-yl]-N-methylpyrimidin-2-amine |
| SMILES | CNc1nccc(-c2cc(N3CC4CCCNC4C3)cs2)n1 |
| InChI | InChI=1S/C16H21N5S/c1-17-16-19-6-4-13(20-16)15-7-12(10-22-15)21-8-11-3-2-5-18-14(11)9-21/h4,6-7,10-11,14,18H,2-3,5,8-9H2,1H3,(H,17,19,20) |
| InChIKey | YRYUSJKZCHLPHX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |