C27H34F3N3O5 — CID 69278657
methyl 4-[[(5-pentylpyridine-2-carbonyl)-piperidin-4-ylamino]methyl]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 69278657) has the molecular formula C27H34F3N3O5 and a molecular weight of 537.58 g/mol. Its IUPAC name is methyl 4-[[(5-pentylpyridine-2-carbonyl)-piperidin-4-ylamino]methyl]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 4-[[(5-pentylpyridine-2-carbonyl)-piperidin-4-ylamino]methyl]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69278657 |
| Molecular Formula | C27H34F3N3O5 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | methyl 4-[[(5-pentylpyridine-2-carbonyl)-piperidin-4-ylamino]methyl]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(C(=O)OC)cc2)C2CCNCC2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33N3O3.C2HF3O2/c1-3-4-5-6-19-9-12-23(27-17-19)24(29)28(22-13-15-26-16-14-22)18-20-7-10-21(11-8-20)25(30)31-2;3-2(4,5)1(6)7/h7-12,17,22,26H,3-6,13-16,18H2,1-2H3;(H,6,7) |
| InChIKey | VGWAOHJCBAWAMR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|