C28H28N4O3 — CID 69280684
2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-[(3-methylphenyl)methyl]propanediamide (PubChem CID 69280684) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-[(3-methylphenyl)methyl]propanediamide.
| Compound Name | 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-[(3-methylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 69280684 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-methyl-N-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-N'-[(3-methylphenyl)methyl]propanediamide |
| SMILES | Cc1cccc(CNC(=O)C(C)C(=O)NC2N=C(c3ccccc3)c3ccccc3N(C)C2=O)c1 |
| InChI | InChI=1S/C28H28N4O3/c1-18-10-9-11-20(16-18)17-29-26(33)19(2)27(34)31-25-28(35)32(3)23-15-8-7-14-22(23)24(30-25)21-12-5-4-6-13-21/h4-16,19,25H,17H2,1-3H3,(H,29,33)(H,31,34) |
| InChIKey | UOOOGSJQFGCVAA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|