C27H35NO3 — CID 69282585
7-amino-1-(1,6-dimethoxycyclohexa-2,4-dien-1-yl)-1,1-diphenylheptan-2-ol (PubChem CID 69282585) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is 7-amino-1-(1,6-dimethoxycyclohexa-2,4-dien-1-yl)-1,1-diphenylheptan-2-ol.
| Compound Name | 7-amino-1-(1,6-dimethoxycyclohexa-2,4-dien-1-yl)-1,1-diphenylheptan-2-ol |
|---|---|
| PubChem CID | 69282585 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 7-amino-1-(1,6-dimethoxycyclohexa-2,4-dien-1-yl)-1,1-diphenylheptan-2-ol |
| SMILES | COC1C=CC=CC1(OC)C(c1ccccc1)(c1ccccc1)C(O)CCCCCN |
| InChI | InChI=1S/C27H35NO3/c1-30-25-19-11-12-20-26(25,31-2)27(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24(29)18-10-5-13-21-28/h3-4,6-9,11-12,14-17,19-20,24-25,29H,5,10,13,18,21,28H2,1-2H3 |
| InChIKey | ALCIAUKUZNFQIA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|