C28H30O5 — CID 14462308
1-(2,5-dimethoxy-2H-furan-5-yl)-2-trityloxypropan-1-ol (PubChem CID 14462308) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-2H-furan-5-yl)-2-trityloxypropan-1-ol.
| Compound Name | 1-(2,5-dimethoxy-2H-furan-5-yl)-2-trityloxypropan-1-ol |
|---|---|
| PubChem CID | 14462308 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-(2,5-dimethoxy-2H-furan-5-yl)-2-trityloxypropan-1-ol |
| SMILES | COC1C=CC(OC)(C(O)C(C)OC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C28H30O5/c1-21(26(29)27(31-3)20-19-25(30-2)33-27)32-28(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-21,25-26,29H,1-3H3 |
| InChIKey | CGQIRHZWFJVGQX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|