C7H12O4 — CID 86312017
[(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]methanol (PubChem CID 86312017) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is [(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]methanol.
| Compound Name | [(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]methanol |
|---|---|
| PubChem CID | 86312017 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | [(2S,5R)-2,5-dimethoxy-2H-furan-5-yl]methanol |
| SMILES | CO[C@@H]1C=C[C@@](CO)(OC)O1 |
| InChI | InChI=1S/C7H12O4/c1-9-6-3-4-7(5-8,10-2)11-6/h3-4,6,8H,5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | ZYTSUANFIPZBDM-NKWVEPMBSA-N |
| XLogP | -0.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|