C9H15NO5 — CID 154138868
1-(2,5-dimethoxy-2H-furan-5-yl)ethyl carbamate (PubChem CID 154138868) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-2H-furan-5-yl)ethyl carbamate.
| Compound Name | 1-(2,5-dimethoxy-2H-furan-5-yl)ethyl carbamate |
|---|---|
| PubChem CID | 154138868 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(2,5-dimethoxy-2H-furan-5-yl)ethyl carbamate |
| SMILES | COC1C=CC(OC)(C(C)OC(N)=O)O1 |
| InChI | InChI=1S/C9H15NO5/c1-6(14-8(10)11)9(13-3)5-4-7(12-2)15-9/h4-7H,1-3H3,(H2,10,11) |
| InChIKey | PQALHDMNXVZPHY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|