C8H15NO3 — CID 99988421
2-[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]ethanamine (PubChem CID 99988421) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]ethanamine.
| Compound Name | 2-[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]ethanamine |
|---|---|
| PubChem CID | 99988421 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]ethanamine |
| SMILES | CO[C@H]1C=C[C@@](CCN)(OC)O1 |
| InChI | InChI=1S/C8H15NO3/c1-10-7-3-4-8(11-2,12-7)5-6-9/h3-4,7H,5-6,9H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | LIDTXJJLHMMBPP-HTQZYQBOSA-N |
| XLogP | 0.24 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|