C14H24O7 — CID 158431138
2,4-dimethoxy-2-methyl-3,6-dioxabicyclo[3.1.0]hexane;2,5-dimethoxy-5-methyl-2H-furan (PubChem CID 158431138) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2,4-dimethoxy-2-methyl-3,6-dioxabicyclo[3.1.0]hexane;2,5-dimethoxy-5-methyl-2H-furan.
| Compound Name | 2,4-dimethoxy-2-methyl-3,6-dioxabicyclo[3.1.0]hexane;2,5-dimethoxy-5-methyl-2H-furan |
|---|---|
| PubChem CID | 158431138 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2,4-dimethoxy-2-methyl-3,6-dioxabicyclo[3.1.0]hexane;2,5-dimethoxy-5-methyl-2H-furan |
| SMILES | COC1C=CC(C)(OC)O1.COC1OC(C)(OC)C2OC12 |
| InChI | InChI=1S/C7H12O4.C7H12O3/c1-7(9-3)5-4(10-5)6(8-2)11-7;1-7(9-3)5-4-6(8-2)10-7/h4-6H,1-3H3;4-6H,1-3H3 |
| InChIKey | HBRBUWUTTUSADQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|