C28H38N6O3 — CID 69290716
N-[[6-[[2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 69290716) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is N-[[6-[[2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[6-[[2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 69290716 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | N-[[6-[[2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | c1cc(CNCCN2CCOCC2)nc(OCC2CCC3CN(c4noc5ccccc45)CCN3C2)c1 |
| InChI | InChI=1S/C28H38N6O3/c1-2-6-26-25(5-1)28(31-37-26)34-13-12-33-19-22(8-9-24(33)20-34)21-36-27-7-3-4-23(30-27)18-29-10-11-32-14-16-35-17-15-32/h1-7,22,24,29H,8-21H2 |
| InChIKey | SSAIEZAUSIKMIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|