C29H39FN6O2 — CID 69293265
N-[[6-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-(1-methylpyrrolidin-2-yl)ethanamine (PubChem CID 69293265) has the molecular formula C29H39FN6O2 and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[[6-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-(1-methylpyrrolidin-2-yl)ethanamine.
| Compound Name | N-[[6-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-(1-methylpyrrolidin-2-yl)ethanamine |
|---|---|
| PubChem CID | 69293265 |
| Molecular Formula | C29H39FN6O2 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | N-[[6-[[2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-2-(1-methylpyrrolidin-2-yl)ethanamine |
| SMILES | CN1CCCC1CCNCc1cccc(OCC2CCC3CN(c4noc5ccc(F)cc45)CCN3C2)n1 |
| InChI | InChI=1S/C29H39FN6O2/c1-34-13-3-5-24(34)11-12-31-17-23-4-2-6-28(32-23)37-20-21-7-9-25-19-36(15-14-35(25)18-21)29-26-16-22(30)8-10-27(26)38-33-29/h2,4,6,8,10,16,21,24-25,31H,3,5,7,9,11-15,17-20H2,1H3 |
| InChIKey | TXIDBESHVYMFIZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|