C25H28N6O2S — CID 87768523
N-[[6-[[(7R,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-1,3-thiazol-2-amine (PubChem CID 87768523) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is N-[[6-[[(7R,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[[6-[[(7R,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87768523 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[[6-[[(7R,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl]-1,3-thiazol-2-amine |
| SMILES | c1cc(CNc2nccs2)nc(OC[C@@H]2CC[C@H]3CN(c4noc5ccccc45)CCN3C2)c1 |
| InChI | InChI=1S/C25H28N6O2S/c1-2-6-22-21(5-1)24(29-33-22)31-12-11-30-15-18(8-9-20(30)16-31)17-32-23-7-3-4-19(28-23)14-27-25-26-10-13-34-25/h1-7,10,13,18,20H,8-9,11-12,14-17H2,(H,26,27)/t18-,20+/m1/s1 |
| InChIKey | VPVXDISLBNNAGB-QUCCMNQESA-N |
| XLogP | 4.27 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |