C22H29NO2 — CID 69293701
3-(3-cyclohexyl-3-hydroxy-3-phenylprop-1-ynyl)-1-azabicyclo[2.2.2]octan-3-ol (PubChem CID 69293701) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 3-(3-cyclohexyl-3-hydroxy-3-phenylprop-1-ynyl)-1-azabicyclo[2.2.2]octan-3-ol.
| Compound Name | 3-(3-cyclohexyl-3-hydroxy-3-phenylprop-1-ynyl)-1-azabicyclo[2.2.2]octan-3-ol |
|---|---|
| PubChem CID | 69293701 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 3-(3-cyclohexyl-3-hydroxy-3-phenylprop-1-ynyl)-1-azabicyclo[2.2.2]octan-3-ol |
| SMILES | OC1(C#CC(O)(c2ccccc2)C2CCCCC2)CN2CCC1CC2 |
| InChI | InChI=1S/C22H29NO2/c24-21(17-23-15-11-18(21)12-16-23)13-14-22(25,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1,3-4,7-8,18,20,24-25H,2,5-6,9-12,15-17H2 |
| InChIKey | YXZJBNNVVYKKDQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|