C32H23N5O6 — CID 69294320
2-amino-1-benzyl-7H-purin-6-one;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 69294320) has the molecular formula C32H23N5O6 and a molecular weight of 573.57 g/mol. Its IUPAC name is 2-amino-1-benzyl-7H-purin-6-one;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2-amino-1-benzyl-7H-purin-6-one;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 69294320 |
| Molecular Formula | C32H23N5O6 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 2-amino-1-benzyl-7H-purin-6-one;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Nc1nc2nc[nH]c2c(=O)n1Cc1ccccc1.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C12H11N5O/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;13-12-16-10-9(14-7-15-10)11(18)17(12)6-8-4-2-1-3-5-8/h1-10,21-22H;1-5,7H,6H2,(H2,13,16)(H,14,15) |
| InChIKey | HOKBDIVSIOJNTM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |