C12H14Cl2N2O — CID 6929498
1-[2-[(1R)-2,2-dichlorocyclopropyl]ethyl]-3-phenylurea (PubChem CID 6929498) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-[2-[(1R)-2,2-dichlorocyclopropyl]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[(1R)-2,2-dichlorocyclopropyl]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 6929498 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[2-[(1R)-2,2-dichlorocyclopropyl]ethyl]-3-phenylurea |
| SMILES | O=C(NCC[C@@H]1CC1(Cl)Cl)Nc1ccccc1 |
| InChI | InChI=1S/C12H14Cl2N2O/c13-12(14)8-9(12)6-7-15-11(17)16-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H2,15,16,17)/t9-/m1/s1 |
| InChIKey | CYOADUWVWUWXDC-SECBINFHSA-N |
| XLogP | 3.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|