C14H18N2O6 — CID 69296093
1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-hydroxyhexyl]pyrrole-2,5-dione (PubChem CID 69296093) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-hydroxyhexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-hydroxyhexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69296093 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-hydroxyhexyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCC(O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H18N2O6/c17-10-5-6-11(18)15(10)9-3-1-2-4-14(21)22-16-12(19)7-8-13(16)20/h5-6,14,21H,1-4,7-9H2 |
| InChIKey | SUXGOTLGGSNYPZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|