C26H32FNO2 — CID 69302313
(1S,3aS,3bR,5E,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-1-hydroxy-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 69302313) has the molecular formula C26H32FNO2 and a molecular weight of 409.55 g/mol. Its IUPAC name is (1S,3aS,3bR,5E,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-1-hydroxy-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (1S,3aS,3bR,5E,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-1-hydroxy-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 69302313 |
| Molecular Formula | C26H32FNO2 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (1S,3aS,3bR,5E,5aR,9aR,9bS,11aS)-5-[(3-fluorophenyl)methylidene]-1-hydroxy-6,9a,11a-trimethyl-1,2,3,3a,3b,4,5a,9b,10,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@@H]3C/C(=C\c3cccc(F)c3)[C@@H]12 |
| InChI | InChI=1S/C26H32FNO2/c1-25-11-9-21-19(20(25)7-8-22(25)29)15-17(13-16-5-4-6-18(27)14-16)24-26(21,2)12-10-23(30)28(24)3/h4-6,10,12-14,19-22,24,29H,7-9,11,15H2,1-3H3/b17-13+/t19-,20-,21-,22-,24+,25-,26+/m0/s1 |
| InChIKey | WWYAKNOOTNOGQI-UAGSGLHYSA-N |
| XLogP | 4.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |