C21H25ClN4O5 — CID 69303811
4-[4-[3-(4-chlorophenyl)-1,3-oxazolidin-4-yl]phenyl]morpholin-3-one;formamide (PubChem CID 69303811) has the molecular formula C21H25ClN4O5 and a molecular weight of 448.91 g/mol. Its IUPAC name is 4-[4-[3-(4-chlorophenyl)-1,3-oxazolidin-4-yl]phenyl]morpholin-3-one;formamide.
| Compound Name | 4-[4-[3-(4-chlorophenyl)-1,3-oxazolidin-4-yl]phenyl]morpholin-3-one;formamide |
|---|---|
| PubChem CID | 69303811 |
| Molecular Formula | C21H25ClN4O5 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[4-[3-(4-chlorophenyl)-1,3-oxazolidin-4-yl]phenyl]morpholin-3-one;formamide |
| SMILES | NC=O.NC=O.O=C1COCCN1c1ccc(C2COCN2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19ClN2O3.2CH3NO/c20-15-3-7-17(8-4-15)22-13-25-11-18(22)14-1-5-16(6-2-14)21-9-10-24-12-19(21)23;2*2-1-3/h1-8,18H,9-13H2;2*1H,(H2,2,3) |
| InChIKey | ZBKLQZPVNSHNLS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|