C22H24ClN4O5+ — CID 87632031
(2R,4R)-1-(4-chlorophenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87632031) has the molecular formula C22H24ClN4O5+ and a molecular weight of 459.91 g/mol. Its IUPAC name is (2R,4R)-1-(4-chlorophenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-(4-chlorophenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87632031 |
| Molecular Formula | C22H24ClN4O5+ |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (2R,4R)-1-(4-chlorophenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | NC(=O)[C@]1(c2ccc(N3CCOCC3=O)cc2)C[C@@H](O)C[N+]1(C(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O5/c23-15-3-7-17(8-4-15)27(21(25)31)12-18(28)11-22(27,20(24)30)14-1-5-16(6-2-14)26-9-10-32-13-19(26)29/h1-8,18,28H,9-13H2,(H3-,24,25,30,31)/p+1/t18-,22-,27?/m1/s1 |
| InChIKey | UHVVZKFJTMCNCR-QEUHBZEUSA-O |
| XLogP | 1.23 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|