C26H27N4O7+ — CID 87648318
2-[(3R,5R)-1,5-dicarbamoyl-1-(4-ethynylphenyl)-5-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-3-yl]oxyacetic acid (PubChem CID 87648318) has the molecular formula C26H27N4O7+ and a molecular weight of 507.52 g/mol. Its IUPAC name is 2-[(3R,5R)-1,5-dicarbamoyl-1-(4-ethynylphenyl)-5-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-3-yl]oxyacetic acid.
| Compound Name | 2-[(3R,5R)-1,5-dicarbamoyl-1-(4-ethynylphenyl)-5-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 87648318 |
| Molecular Formula | C26H27N4O7+ |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[(3R,5R)-1,5-dicarbamoyl-1-(4-ethynylphenyl)-5-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-3-yl]oxyacetic acid |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)C[C@H](OCC(=O)O)C[C@]2(C(N)=O)c2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O7/c1-2-17-3-9-20(10-4-17)30(25(28)35)14-21(37-16-23(32)33)13-26(30,24(27)34)18-5-7-19(8-6-18)29-11-12-36-15-22(29)31/h1,3-10,21H,11-16H2,(H4-,27,28,32,33,34,35)/p+1/t21-,26-,30?/m1/s1 |
| InChIKey | FISOOTQRRVLJBS-JLQBAKLKSA-O |
| XLogP | 0.67 |
| TPSA | 162.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|