C24H25N4O5+ — CID 87648984
(2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87648984) has the molecular formula C24H25N4O5+ and a molecular weight of 449.49 g/mol. Its IUPAC name is (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87648984 |
| Molecular Formula | C24H25N4O5+ |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)C[C@H](O)C[C@]2(C(N)=O)c2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O5/c1-2-16-3-9-19(10-4-16)28(23(26)32)14-20(29)13-24(28,22(25)31)17-5-7-18(8-6-17)27-11-12-33-15-21(27)30/h1,3-10,20,29H,11-15H2,(H3-,25,26,31,32)/p+1/t20-,24-,28?/m1/s1 |
| InChIKey | WKRPMPPZKFPUGR-NYKNRPNFSA-O |
| XLogP | 0.56 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|