C24H25N4O4+ — CID 87648030
(2R)-1-(4-ethynylphenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87648030) has the molecular formula C24H25N4O4+ and a molecular weight of 433.49 g/mol. Its IUPAC name is (2R)-1-(4-ethynylphenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R)-1-(4-ethynylphenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87648030 |
| Molecular Formula | C24H25N4O4+ |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2R)-1-(4-ethynylphenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)CCC[C@]2(C(N)=O)c2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O4/c1-2-17-4-10-20(11-5-17)28(23(26)31)14-3-12-24(28,22(25)30)18-6-8-19(9-7-18)27-13-15-32-16-21(27)29/h1,4-11H,3,12-16H2,(H3-,25,26,30,31)/p+1/t24-,28?/m1/s1 |
| InChIKey | KZXSZQODZBBQDS-RIBGEGAISA-O |
| XLogP | 1.59 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|