C25H27N4O4+ — CID 87648724
(2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(2-oxopiperidin-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87648724) has the molecular formula C25H27N4O4+ and a molecular weight of 447.52 g/mol. Its IUPAC name is (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(2-oxopiperidin-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(2-oxopiperidin-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87648724 |
| Molecular Formula | C25H27N4O4+ |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2R,4R)-1-(4-ethynylphenyl)-4-hydroxy-2-[4-(2-oxopiperidin-1-yl)phenyl]pyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C#Cc1ccc([N+]2(C(N)=O)C[C@H](O)C[C@]2(C(N)=O)c2ccc(N3CCCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-2-17-6-12-20(13-7-17)29(24(27)33)16-21(30)15-25(29,23(26)32)18-8-10-19(11-9-18)28-14-4-3-5-22(28)31/h1,6-13,21,30H,3-5,14-16H2,(H3-,26,27,32,33)/p+1/t21-,25-,29?/m1/s1 |
| InChIKey | XQSNUPBQRGXCMZ-OOSJUCDLSA-O |
| XLogP | 1.72 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|