C25H28ClN4O5+ — CID 87633712
(2R,4R)-1-(4-chlorophenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]-4-prop-2-enoxypyrrolidin-1-ium-1,2-dicarboxamide (PubChem CID 87633712) has the molecular formula C25H28ClN4O5+ and a molecular weight of 499.98 g/mol. Its IUPAC name is (2R,4R)-1-(4-chlorophenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]-4-prop-2-enoxypyrrolidin-1-ium-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-(4-chlorophenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]-4-prop-2-enoxypyrrolidin-1-ium-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87633712 |
| Molecular Formula | C25H28ClN4O5+ |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (2R,4R)-1-(4-chlorophenyl)-2-[4-(3-oxomorpholin-4-yl)phenyl]-4-prop-2-enoxypyrrolidin-1-ium-1,2-dicarboxamide |
| SMILES | C=CCO[C@@H]1C[C@](C(N)=O)(c2ccc(N3CCOCC3=O)cc2)[N+](C(N)=O)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H27ClN4O5/c1-2-12-35-21-14-25(23(27)32,30(15-21,24(28)33)20-9-5-18(26)6-10-20)17-3-7-19(8-4-17)29-11-13-34-16-22(29)31/h2-10,21H,1,11-16H2,(H3-,27,28,32,33)/p+1/t21-,25-,30?/m1/s1 |
| InChIKey | MBUNOLMTDJCIAF-LCSPPKPPSA-O |
| XLogP | 2.44 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|