C23H23N3O7S — CID 76842188
[3-methylsulfonyl-1-oxo-1-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] N-(4-ethynylphenyl)carbamate (PubChem CID 76842188) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is [3-methylsulfonyl-1-oxo-1-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] N-(4-ethynylphenyl)carbamate.
| Compound Name | [3-methylsulfonyl-1-oxo-1-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] N-(4-ethynylphenyl)carbamate |
|---|---|
| PubChem CID | 76842188 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | [3-methylsulfonyl-1-oxo-1-[4-(3-oxomorpholin-4-yl)anilino]propan-2-yl] N-(4-ethynylphenyl)carbamate |
| SMILES | C#Cc1ccc(NC(=O)OC(CS(C)(=O)=O)C(=O)Nc2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O7S/c1-3-16-4-6-18(7-5-16)25-23(29)33-20(15-34(2,30)31)22(28)24-17-8-10-19(11-9-17)26-12-13-32-14-21(26)27/h1,4-11,20H,12-15H2,2H3,(H,24,28)(H,25,29) |
| InChIKey | WJNIYUSICIRCSV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|