C16H20F2N4O4 — CID 87869078
(2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[4-(3-oxomorpholin-4-yl)phenyl]propanediamide (PubChem CID 87869078) has the molecular formula C16H20F2N4O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[4-(3-oxomorpholin-4-yl)phenyl]propanediamide.
| Compound Name | (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87869078 |
| Molecular Formula | C16H20F2N4O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
| SMILES | CN(CC(F)F)[C@H](C(N)=O)C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C16H20F2N4O4/c1-21(8-12(17)18)14(15(19)24)16(25)20-10-2-4-11(5-3-10)22-6-7-26-9-13(22)23/h2-5,12,14H,6-9H2,1H3,(H2,19,24)(H,20,25)/t14-/m1/s1 |
| InChIKey | XZMOJGLFEDIETJ-CQSZACIVSA-N |
| XLogP | 0.04 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|