C20H23F5N4O4 — CID 87869023
(2S)-2-[cyclobutyl(2,2-difluoroethyl)amino]-N'-[4-(3-oxomorpholin-4-yl)-3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 87869023) has the molecular formula C20H23F5N4O4 and a molecular weight of 478.42 g/mol. Its IUPAC name is (2S)-2-[cyclobutyl(2,2-difluoroethyl)amino]-N'-[4-(3-oxomorpholin-4-yl)-3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | (2S)-2-[cyclobutyl(2,2-difluoroethyl)amino]-N'-[4-(3-oxomorpholin-4-yl)-3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87869023 |
| Molecular Formula | C20H23F5N4O4 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (2S)-2-[cyclobutyl(2,2-difluoroethyl)amino]-N'-[4-(3-oxomorpholin-4-yl)-3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | NC(=O)[C@@H](C(=O)Nc1ccc(N2CCOCC2=O)c(C(F)(F)F)c1)N(CC(F)F)C1CCC1 |
| InChI | InChI=1S/C20H23F5N4O4/c21-15(22)9-29(12-2-1-3-12)17(18(26)31)19(32)27-11-4-5-14(13(8-11)20(23,24)25)28-6-7-33-10-16(28)30/h4-5,8,12,15,17H,1-3,6-7,9-10H2,(H2,26,31)(H,27,32)/t17-/m0/s1 |
| InChIKey | IBMSSJIBLXYAMI-KRWDZBQOSA-N |
| XLogP | 1.98 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|