C19H22F4N4O4 — CID 87869027
(2R)-2-[cyclopropyl(2,2-difluoroethyl)amino]-N'-[2-(difluoromethyl)-4-(3-oxomorpholin-4-yl)phenyl]propanediamide (PubChem CID 87869027) has the molecular formula C19H22F4N4O4 and a molecular weight of 446.40 g/mol. Its IUPAC name is (2R)-2-[cyclopropyl(2,2-difluoroethyl)amino]-N'-[2-(difluoromethyl)-4-(3-oxomorpholin-4-yl)phenyl]propanediamide.
| Compound Name | (2R)-2-[cyclopropyl(2,2-difluoroethyl)amino]-N'-[2-(difluoromethyl)-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87869027 |
| Molecular Formula | C19H22F4N4O4 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (2R)-2-[cyclopropyl(2,2-difluoroethyl)amino]-N'-[2-(difluoromethyl)-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
| SMILES | NC(=O)[C@H](C(=O)Nc1ccc(N2CCOCC2=O)cc1C(F)F)N(CC(F)F)C1CC1 |
| InChI | InChI=1S/C19H22F4N4O4/c20-14(21)8-27(10-1-2-10)16(18(24)29)19(30)25-13-4-3-11(7-12(13)17(22)23)26-5-6-31-9-15(26)28/h3-4,7,10,14,16-17H,1-2,5-6,8-9H2,(H2,24,29)(H,25,30)/t16-/m1/s1 |
| InChIKey | OIVNVVGVHZIEAA-MRXNPFEDSA-N |
| XLogP | 1.51 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|