C16H19F3N4O4 — CID 87869026
(2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide (PubChem CID 87869026) has the molecular formula C16H19F3N4O4 and a molecular weight of 388.35 g/mol. Its IUPAC name is (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide.
| Compound Name | (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87869026 |
| Molecular Formula | C16H19F3N4O4 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R)-2-[2,2-difluoroethyl(methyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
| SMILES | CN(CC(F)F)[C@H](C(N)=O)C(=O)Nc1ccc(N2CCOCC2=O)c(F)c1 |
| InChI | InChI=1S/C16H19F3N4O4/c1-22(7-12(18)19)14(15(20)25)16(26)21-9-2-3-11(10(17)6-9)23-4-5-27-8-13(23)24/h2-3,6,12,14H,4-5,7-8H2,1H3,(H2,20,25)(H,21,26)/t14-/m1/s1 |
| InChIKey | UDZBQPFAUUWCCX-CQSZACIVSA-N |
| XLogP | 0.18 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|