C17H17F7N4O4 — CID 87868468
(2S)-2-[bis(2,2,2-trifluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide (PubChem CID 87868468) has the molecular formula C17H17F7N4O4 and a molecular weight of 474.33 g/mol. Its IUPAC name is (2S)-2-[bis(2,2,2-trifluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide.
| Compound Name | (2S)-2-[bis(2,2,2-trifluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87868468 |
| Molecular Formula | C17H17F7N4O4 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (2S)-2-[bis(2,2,2-trifluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
| SMILES | NC(=O)[C@@H](C(=O)Nc1ccc(N2CCOCC2=O)c(F)c1)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C17H17F7N4O4/c18-10-5-9(1-2-11(10)28-3-4-32-6-12(28)29)26-15(31)13(14(25)30)27(7-16(19,20)21)8-17(22,23)24/h1-2,5,13H,3-4,6-8H2,(H2,25,30)(H,26,31)/t13-/m0/s1 |
| InChIKey | OJKDJQPDKLMISA-ZDUSSCGKSA-N |
| XLogP | 1.41 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|