C20H25F3N4O4 — CID 87869136
(2S)-2-[cyclobutylmethyl(2,2-difluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide (PubChem CID 87869136) has the molecular formula C20H25F3N4O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is (2S)-2-[cyclobutylmethyl(2,2-difluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide.
| Compound Name | (2S)-2-[cyclobutylmethyl(2,2-difluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87869136 |
| Molecular Formula | C20H25F3N4O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (2S)-2-[cyclobutylmethyl(2,2-difluoroethyl)amino]-N'-[3-fluoro-4-(3-oxomorpholin-4-yl)phenyl]propanediamide |
| SMILES | NC(=O)[C@@H](C(=O)Nc1ccc(N2CCOCC2=O)c(F)c1)N(CC(F)F)CC1CCC1 |
| InChI | InChI=1S/C20H25F3N4O4/c21-14-8-13(4-5-15(14)27-6-7-31-11-17(27)28)25-20(30)18(19(24)29)26(10-16(22)23)9-12-2-1-3-12/h4-5,8,12,16,18H,1-3,6-7,9-11H2,(H2,24,29)(H,25,30)/t18-/m0/s1 |
| InChIKey | OZQLEUJRESOEGL-SFHVURJKSA-N |
| XLogP | 1.35 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|