C17H22N4O2S — CID 69307282
7-[2-(2-aminoethoxy)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (PubChem CID 69307282) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 7-[2-(2-aminoethoxy)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
| Compound Name | 7-[2-(2-aminoethoxy)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 69307282 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 7-[2-(2-aminoethoxy)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3cc(OCCOCCN)ccc3c2s1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-3-14-21-15-16(24-14)12-5-4-11(10-13(12)20-17(15)19)23-9-8-22-7-6-18/h4-5,10H,2-3,6-9,18H2,1H3,(H2,19,20) |
| InChIKey | HDYWXGYZBWMMSA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|