C23H28F2N+ — CID 69312222
(1R,5S)-3-[2,2-bis(3-fluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 69312222) has the molecular formula C23H28F2N+ and a molecular weight of 356.48 g/mol. Its IUPAC name is (1R,5S)-3-[2,2-bis(3-fluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-[2,2-bis(3-fluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 69312222 |
| Molecular Formula | C23H28F2N+ |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (1R,5S)-3-[2,2-bis(3-fluorophenyl)ethyl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(CC(c1cccc(F)c1)c1cccc(F)c1)C2 |
| InChI | InChI=1S/C23H28F2N/c1-26(2)21-9-10-22(26)12-16(11-21)13-23(17-5-3-7-19(24)14-17)18-6-4-8-20(25)15-18/h3-8,14-16,21-23H,9-13H2,1-2H3/q+1/t16?,21-,22+ |
| InChIKey | VVAYOGZLURPFKP-WKRVNPTQSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|