C26H27FN2O3 — CID 69314181
6-amino-4-(4-fluorophenyl)-5-[(E)-4-phenylmethoxybut-1-enyl]-2-propan-2-ylpyridine-3-carboxylic acid (PubChem CID 69314181) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is 6-amino-4-(4-fluorophenyl)-5-[(E)-4-phenylmethoxybut-1-enyl]-2-propan-2-ylpyridine-3-carboxylic acid.
| Compound Name | 6-amino-4-(4-fluorophenyl)-5-[(E)-4-phenylmethoxybut-1-enyl]-2-propan-2-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69314181 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-amino-4-(4-fluorophenyl)-5-[(E)-4-phenylmethoxybut-1-enyl]-2-propan-2-ylpyridine-3-carboxylic acid |
| SMILES | CC(C)c1nc(N)c(/C=C/CCOCc2ccccc2)c(-c2ccc(F)cc2)c1C(=O)O |
| InChI | InChI=1S/C26H27FN2O3/c1-17(2)24-23(26(30)31)22(19-11-13-20(27)14-12-19)21(25(28)29-24)10-6-7-15-32-16-18-8-4-3-5-9-18/h3-6,8-14,17H,7,15-16H2,1-2H3,(H2,28,29)(H,30,31)/b10-6+ |
| InChIKey | WEFQFSCRRHYIIG-UXBLZVDNSA-N |
| XLogP | 5.91 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|