C18H22N2O5S — CID 69318720
2-hydroxy-2-methyl-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide (PubChem CID 69318720) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide.
| Compound Name | 2-hydroxy-2-methyl-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide |
|---|---|
| PubChem CID | 69318720 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide |
| SMILES | Cc1ccc(Oc2ccc(N(CC(C)(O)C(N)=O)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-13-4-8-15(9-5-13)25-16-10-6-14(7-11-16)20(26(3,23)24)12-18(2,22)17(19)21/h4-11,22H,12H2,1-3H3,(H2,19,21) |
| InChIKey | RURXHIBEBHJCIT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |