C25H32N2O2 — CID 69320285
2-(nonylamino)-2-phenyl-1H-quinoline-4-carboxylic acid (PubChem CID 69320285) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-(nonylamino)-2-phenyl-1H-quinoline-4-carboxylic acid.
| Compound Name | 2-(nonylamino)-2-phenyl-1H-quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 69320285 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-(nonylamino)-2-phenyl-1H-quinoline-4-carboxylic acid |
| SMILES | CCCCCCCCCNC1(c2ccccc2)C=C(C(=O)O)c2ccccc2N1 |
| InChI | InChI=1S/C25H32N2O2/c1-2-3-4-5-6-7-13-18-26-25(20-14-9-8-10-15-20)19-22(24(28)29)21-16-11-12-17-23(21)27-25/h8-12,14-17,19,26-27H,2-7,13,18H2,1H3,(H,28,29) |
| InChIKey | RMJRJLRKEPGSQO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|