C17H26N2O2S — CID 69466960
2-(2-octylsulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid (PubChem CID 69466960) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-(2-octylsulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid.
| Compound Name | 2-(2-octylsulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 69466960 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(2-octylsulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid |
| SMILES | CCCCCCCCSC1(CC(=O)O)Nc2ccccc2N1 |
| InChI | InChI=1S/C17H26N2O2S/c1-2-3-4-5-6-9-12-22-17(13-16(20)21)18-14-10-7-8-11-15(14)19-17/h7-8,10-11,18-19H,2-6,9,12-13H2,1H3,(H,20,21) |
| InChIKey | XWDNUFVSIDUTEF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|