C28H40N2O2S2 — CID 20554105
N-hexylsulfanyl-N'-octylsulfanyl-N,N'-diphenyloxamide (PubChem CID 20554105) has the molecular formula C28H40N2O2S2 and a molecular weight of 500.77 g/mol. Its IUPAC name is N-hexylsulfanyl-N'-octylsulfanyl-N,N'-diphenyloxamide.
| Compound Name | N-hexylsulfanyl-N'-octylsulfanyl-N,N'-diphenyloxamide |
|---|---|
| PubChem CID | 20554105 |
| Molecular Formula | C28H40N2O2S2 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-hexylsulfanyl-N'-octylsulfanyl-N,N'-diphenyloxamide |
| SMILES | CCCCCCCCSN(C(=O)C(=O)N(SCCCCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H40N2O2S2/c1-3-5-7-9-10-18-24-34-30(26-21-15-12-16-22-26)28(32)27(31)29(25-19-13-11-14-20-25)33-23-17-8-6-4-2/h11-16,19-22H,3-10,17-18,23-24H2,1-2H3 |
| InChIKey | XOOGEFXQFBFVDH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|