C37H42N4O — CID 69325741
[4-[[[2-(3-butyl-2,5-diphenylimidazol-4-yl)-1-[4-(dimethylamino)phenyl]ethyl]amino]methyl]phenyl]methanol (PubChem CID 69325741) has the molecular formula C37H42N4O and a molecular weight of 558.77 g/mol. Its IUPAC name is [4-[[[2-(3-butyl-2,5-diphenylimidazol-4-yl)-1-[4-(dimethylamino)phenyl]ethyl]amino]methyl]phenyl]methanol.
| Compound Name | [4-[[[2-(3-butyl-2,5-diphenylimidazol-4-yl)-1-[4-(dimethylamino)phenyl]ethyl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 69325741 |
| Molecular Formula | C37H42N4O |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | [4-[[[2-(3-butyl-2,5-diphenylimidazol-4-yl)-1-[4-(dimethylamino)phenyl]ethyl]amino]methyl]phenyl]methanol |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CC(NCc1ccc(CO)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C37H42N4O/c1-4-5-24-41-35(36(31-12-8-6-9-13-31)39-37(41)32-14-10-7-11-15-32)25-34(30-20-22-33(23-21-30)40(2)3)38-26-28-16-18-29(27-42)19-17-28/h6-23,34,38,42H,4-5,24-27H2,1-3H3 |
| InChIKey | GWDQOUZHNINOBA-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|