C36H38N4O4S — CID 69327234
[4-[[[1-(3-butyl-2,5-diphenylimidazol-4-yl)-2-(4-sulfamoylphenyl)ethyl]amino]methyl]phenyl] acetate (PubChem CID 69327234) has the molecular formula C36H38N4O4S and a molecular weight of 622.79 g/mol. Its IUPAC name is [4-[[[1-(3-butyl-2,5-diphenylimidazol-4-yl)-2-(4-sulfamoylphenyl)ethyl]amino]methyl]phenyl] acetate.
| Compound Name | [4-[[[1-(3-butyl-2,5-diphenylimidazol-4-yl)-2-(4-sulfamoylphenyl)ethyl]amino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 69327234 |
| Molecular Formula | C36H38N4O4S |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | [4-[[[1-(3-butyl-2,5-diphenylimidazol-4-yl)-2-(4-sulfamoylphenyl)ethyl]amino]methyl]phenyl] acetate |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1C(Cc1ccc(S(N)(=O)=O)cc1)NCc1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C36H38N4O4S/c1-3-4-23-40-35(34(29-11-7-5-8-12-29)39-36(40)30-13-9-6-10-14-30)33(24-27-17-21-32(22-18-27)45(37,42)43)38-25-28-15-19-31(20-16-28)44-26(2)41/h5-22,33,38H,3-4,23-25H2,1-2H3,(H2,37,42,43) |
| InChIKey | NOHMCDNSZKQXHB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|