C32H39N3O2 — CID 90972990
4-[[1-[3-butyl-2-(2-methoxyphenyl)-5-phenylimidazol-4-yl]pentylamino]methyl]phenol (PubChem CID 90972990) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 4-[[1-[3-butyl-2-(2-methoxyphenyl)-5-phenylimidazol-4-yl]pentylamino]methyl]phenol.
| Compound Name | 4-[[1-[3-butyl-2-(2-methoxyphenyl)-5-phenylimidazol-4-yl]pentylamino]methyl]phenol |
|---|---|
| PubChem CID | 90972990 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 4-[[1-[3-butyl-2-(2-methoxyphenyl)-5-phenylimidazol-4-yl]pentylamino]methyl]phenol |
| SMILES | CCCCC(NCc1ccc(O)cc1)c1c(-c2ccccc2)nc(-c2ccccc2OC)n1CCCC |
| InChI | InChI=1S/C32H39N3O2/c1-4-6-16-28(33-23-24-18-20-26(36)21-19-24)31-30(25-13-9-8-10-14-25)34-32(35(31)22-7-5-2)27-15-11-12-17-29(27)37-3/h8-15,17-21,28,33,36H,4-7,16,22-23H2,1-3H3 |
| InChIKey | WHYDFHKRHIWUCK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |