C31H44N4O — CID 91235657
4-[[1-(3-butyl-5-tert-butyl-2-phenylimidazol-4-yl)pentylamino]methyl]-N-methylbenzamide (PubChem CID 91235657) has the molecular formula C31H44N4O and a molecular weight of 488.72 g/mol. Its IUPAC name is 4-[[1-(3-butyl-5-tert-butyl-2-phenylimidazol-4-yl)pentylamino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[1-(3-butyl-5-tert-butyl-2-phenylimidazol-4-yl)pentylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91235657 |
| Molecular Formula | C31H44N4O |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 4-[[1-(3-butyl-5-tert-butyl-2-phenylimidazol-4-yl)pentylamino]methyl]-N-methylbenzamide |
| SMILES | CCCCC(NCc1ccc(C(=O)NC)cc1)c1c(C(C)(C)C)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C31H44N4O/c1-7-9-16-26(33-22-23-17-19-25(20-18-23)30(36)32-6)27-28(31(3,4)5)34-29(35(27)21-10-8-2)24-14-12-11-13-15-24/h11-15,17-20,26,33H,7-10,16,21-22H2,1-6H3,(H,32,36) |
| InChIKey | BLOOHQVALDYHEQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |