C33H45N3O2 — CID 69325860
3-[[1-(3-butyl-2-phenylimidazol-4-yl)pentyl-(cyclohexylmethyl)amino]methyl]benzoic acid (PubChem CID 69325860) has the molecular formula C33H45N3O2 and a molecular weight of 515.74 g/mol. Its IUPAC name is 3-[[1-(3-butyl-2-phenylimidazol-4-yl)pentyl-(cyclohexylmethyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[1-(3-butyl-2-phenylimidazol-4-yl)pentyl-(cyclohexylmethyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 69325860 |
| Molecular Formula | C33H45N3O2 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | 3-[[1-(3-butyl-2-phenylimidazol-4-yl)pentyl-(cyclohexylmethyl)amino]methyl]benzoic acid |
| SMILES | CCCCC(c1cnc(-c2ccccc2)n1CCCC)N(Cc1cccc(C(=O)O)c1)CC1CCCCC1 |
| InChI | InChI=1S/C33H45N3O2/c1-3-5-20-30(31-23-34-32(36(31)21-6-4-2)28-17-11-8-12-18-28)35(24-26-14-9-7-10-15-26)25-27-16-13-19-29(22-27)33(37)38/h8,11-13,16-19,22-23,26,30H,3-7,9-10,14-15,20-21,24-25H2,1-2H3,(H,37,38) |
| InChIKey | OWFJTWULRYDTJD-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |