C29H41N3O — CID 69326413
3-[[butyl-[1-(3-butyl-2-phenylimidazol-4-yl)pentyl]amino]methyl]phenol (PubChem CID 69326413) has the molecular formula C29H41N3O and a molecular weight of 447.67 g/mol. Its IUPAC name is 3-[[butyl-[1-(3-butyl-2-phenylimidazol-4-yl)pentyl]amino]methyl]phenol.
| Compound Name | 3-[[butyl-[1-(3-butyl-2-phenylimidazol-4-yl)pentyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 69326413 |
| Molecular Formula | C29H41N3O |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | 3-[[butyl-[1-(3-butyl-2-phenylimidazol-4-yl)pentyl]amino]methyl]phenol |
| SMILES | CCCCC(c1cnc(-c2ccccc2)n1CCCC)N(CCCC)Cc1cccc(O)c1 |
| InChI | InChI=1S/C29H41N3O/c1-4-7-18-27(31(19-8-5-2)23-24-14-13-17-26(33)21-24)28-22-30-29(32(28)20-9-6-3)25-15-11-10-12-16-25/h10-17,21-22,27,33H,4-9,18-20,23H2,1-3H3 |
| InChIKey | FQWRUXYXAOCOKT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |