C35H37N3O2 — CID 69326576
4-[1-[benzyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]ethyl]benzene-1,3-diol (PubChem CID 69326576) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is 4-[1-[benzyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[benzyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 69326576 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 4-[1-[benzyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]ethyl]benzene-1,3-diol |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CN(Cc1ccccc1)C(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C35H37N3O2/c1-3-4-22-38-32(34(28-16-10-6-11-17-28)36-35(38)29-18-12-7-13-19-29)25-37(24-27-14-8-5-9-15-27)26(2)31-21-20-30(39)23-33(31)40/h5-21,23,26,39-40H,3-4,22,24-25H2,1-2H3 |
| InChIKey | ZZSVSFZCTRUHDB-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|