C8H11N7 — CID 69327704
6-(1-imidazol-1-ylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 69327704) has the molecular formula C8H11N7 and a molecular weight of 205.23 g/mol. Its IUPAC name is 6-(1-imidazol-1-ylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-imidazol-1-ylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 69327704 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-(1-imidazol-1-ylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(c1nc(N)nc(N)n1)n1ccnc1 |
| InChI | InChI=1S/C8H11N7/c1-5(15-3-2-11-4-15)6-12-7(9)14-8(10)13-6/h2-5H,1H3,(H4,9,10,12,13,14) |
| InChIKey | VYKCUFFTIHOWIP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |