C13H25Cl2N3O7 — CID 69332828
(2S)-2-amino-5-[3-(4-nitrooxypiperidin-1-yl)propoxy]-5-oxopentanoic acid;dihydrochloride (PubChem CID 69332828) has the molecular formula C13H25Cl2N3O7 and a molecular weight of 406.26 g/mol. Its IUPAC name is (2S)-2-amino-5-[3-(4-nitrooxypiperidin-1-yl)propoxy]-5-oxopentanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-5-[3-(4-nitrooxypiperidin-1-yl)propoxy]-5-oxopentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 69332828 |
| Molecular Formula | C13H25Cl2N3O7 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (2S)-2-amino-5-[3-(4-nitrooxypiperidin-1-yl)propoxy]-5-oxopentanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CCC(=O)OCCCN1CCC(O[N+](=O)[O-])CC1)C(=O)O |
| InChI | InChI=1S/C13H23N3O7.2ClH/c14-11(13(18)19)2-3-12(17)22-9-1-6-15-7-4-10(5-8-15)23-16(20)21;;/h10-11H,1-9,14H2,(H,18,19);2*1H/t11-;;/m0../s1 |
| InChIKey | QGIXQYDIHLAUDP-IDMXKUIJSA-N |
| XLogP | 0.63 |
| TPSA | 145.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|