C10H17N3O6 — CID 72979312
2-amino-5-(4-nitrooxypiperidin-1-yl)-5-oxopentanoic acid (PubChem CID 72979312) has the molecular formula C10H17N3O6 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-amino-5-(4-nitrooxypiperidin-1-yl)-5-oxopentanoic acid.
| Compound Name | 2-amino-5-(4-nitrooxypiperidin-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 72979312 |
| Molecular Formula | C10H17N3O6 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-amino-5-(4-nitrooxypiperidin-1-yl)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)N1CCC(O[N+](=O)[O-])CC1)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c11-8(10(15)16)1-2-9(14)12-5-3-7(4-6-12)19-13(17)18/h7-8H,1-6,11H2,(H,15,16) |
| InChIKey | OAQKVSOUQZWFEF-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|